CAS 869464-86-8

2,3-Dihydro-6-nitro-3-oxo-4H-1,4-benzoxazine-4-acetic acid

Description:

2,3-Dihydro-6-nitro-3-oxo-4H-1,4-benzoxazine-4-acetic acid is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazine ring fused with a carboxylic acid group. This compound features a nitro group at the 6-position and a keto group at the 3-position, contributing to its reactivity and potential biological activity. The presence of the acetic acid moiety enhances its solubility in polar solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which may lead to pharmacological effects. Its CAS number, 869464-86-8, allows for easy identification in chemical databases. As with many nitro-containing compounds, it may exhibit specific properties such as stability under certain conditions, but care should be taken due to the potential for nitro groups to undergo reduction reactions. Overall, 2,3-Dihydro-6-nitro-3-oxo-4H-1,4-benzoxazine-4-acetic acid represents a class of compounds with diverse applications in research and industry.

Formula: C₁₀H₈N₂O₆

InChI: InChI=1S/C10H8N2O6/c13-9-5-18-8-2-1-6(12(16)17)3-7(8)11(9)4-10(14)15/h1-3H,4-5H2,(H,14,15)

InChI key: InChIKey=BKZJXMCGQRZVLP-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=2C(=CC=C(N(=O)=O)C2)OCC1=O

Synonyms:

• 4H-1,4-Benzoxazine-4-acetic acid, 2,3-dihydro-6-nitro-3-oxo-
• 2,3-Dihydro-6-nitro-3-oxo-4H-1,4-benzoxazine-4-acetic acid