CAS 869464-87-9

2-Oxo-5-(2-thienyl)-1,3,4-oxadiazole-3(2H)-acetic acid

Description:

2-Oxo-5-(2-thienyl)-1,3,4-oxadiazole-3(2H)-acetic acid is a heterocyclic compound characterized by its oxadiazole ring, which contains both nitrogen and oxygen atoms, contributing to its unique chemical properties. The presence of a thienyl group, derived from thiophene, enhances its aromatic character and may influence its reactivity and solubility. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its structure suggests potential for hydrogen bonding due to the carboxylic acid functional group, which can also participate in various chemical reactions, such as esterification or amidation. The oxadiazole moiety is known for its stability and can serve as a scaffold for further chemical modifications. Additionally, the compound may display interesting electronic properties due to the conjugation between the thienyl group and the oxadiazole ring, potentially leading to applications in organic electronics or as a fluorescent material. Overall, 2-Oxo-5-(2-thienyl)-1,3,4-oxadiazole-3(2H)-acetic acid represents a versatile structure with significant implications in both synthetic and applied chemistry.

Formula: C₈H₆N₂O₄S

InChI: InChI=1S/C8H6N2O4S/c11-6(12)4-10-8(13)14-7(9-10)5-2-1-3-15-5/h1-3H,4H2,(H,11,12)

InChI key: InChIKey=ZTKUPPLGYYWWIJ-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(OC1=O)C2=CC=CS2

Synonyms:

• 1,3,4-Oxadiazole-3(2H)-acetic acid, 2-oxo-5-(2-thienyl)-
• 2-Oxo-5-(2-thienyl)-1,3,4-oxadiazole-3(2H)-acetic acid

2-[2-Oxo-5-(thiophen-2-yl)-2,3-dihydro-1,3,4-oxadiazol-3-yl]acetic acid

CAS: 869464-87-9

Versatile small molecule scaffold

Formula: C₈H₆N₂O₄S

Purity: Min. 95%

Molecular weight: 226.21 g/mol

Ref: 3D-UJB46487