CAS 869472-65-1

2-Oxo-1(2H)-pyridineacetic acid hydrazide

Description:

2-Oxo-1(2H)-pyridineacetic acid hydrazide, with the CAS number 869472-65-1, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a hydrazide functional group. This compound typically exhibits properties associated with both pyridine derivatives and hydrazides, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. It may be soluble in polar solvents, reflecting the presence of functional groups that can engage in dipole-dipole interactions. The compound's reactivity can be influenced by the carbonyl group adjacent to the hydrazide, which may participate in various chemical reactions, including condensation and nucleophilic attacks. Additionally, derivatives of such compounds are often explored for their pharmacological properties, making them of interest in medicinal chemistry. Overall, 2-Oxo-1(2H)-pyridineacetic acid hydrazide represents a versatile structure with potential applications in research and development within the field of organic and medicinal chemistry.

Formula: C₇H₉N₃O₂

InChI: InChI=1S/C7H9N3O2/c8-9-6(11)5-10-4-2-1-3-7(10)12/h1-4H,5,8H2,(H,9,11)

InChI key: InChIKey=BWWMBBGDYITYLV-UHFFFAOYSA-N

SMILES: C(C(NN)=O)N1C(=O)C=CC=C1

Synonyms:

• 2-(2-Oxo-1,2-dihydropyridin-1-yl)acetohydrazide
• 2-(2-Oxopyridin-1(2H)-Yl)Acetohydrazide
• 1(2H)-Pyridineacetic acid, 2-oxo-, hydrazide
• 2-Oxo-1(2H)-pyridineacetic acid hydrazide