
CAS 869472-70-8
:Ethyl 2-[3-[(5-acetyl-2-ethoxyphenyl)methyl]-4-oxo-2-thiazolidinylidene]acetate
Description:
Ethyl 2-[3-[(5-acetyl-2-ethoxyphenyl)methyl]-4-oxo-2-thiazolidinylidene]acetate, identified by its CAS number 869472-70-8, is a synthetic organic compound characterized by its complex structure, which includes a thiazolidine ring and an ethyl acetate moiety. This compound typically exhibits properties associated with thiazolidinones, such as potential biological activity, including anti-inflammatory and antimicrobial effects. The presence of the acetyl and ethoxy groups suggests that it may have moderate solubility in organic solvents and limited solubility in water. Its molecular structure indicates potential for reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl groups. Additionally, the compound may exhibit specific optical activity due to the presence of chiral centers, which can influence its pharmacological properties. Overall, this compound's unique structural features make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C18H21NO5S
InChI:InChI=1S/C18H21NO5S/c1-4-23-15-7-6-13(12(3)20)8-14(15)10-19-16(21)11-25-17(19)9-18(22)24-5-2/h6-9H,4-5,10-11H2,1-3H3
InChI key:InChIKey=KGYDGECQNLZIHY-UHFFFAOYSA-N
SMILES:C(N1C(=CC(OCC)=O)SCC1=O)C2=C(OCC)C=CC(C(C)=O)=C2
Synonyms:- Acetic acid, 2-[3-[(5-acetyl-2-ethoxyphenyl)methyl]-4-oxo-2-thiazolidinylidene]-, ethyl ester
- Ethyl 2-[3-[(5-acetyl-2-ethoxyphenyl)methyl]-4-oxo-2-thiazolidinylidene]acetate
- Acetic acid, [3-[(5-acetyl-2-ethoxyphenyl)methyl]-4-oxo-2-thiazolidinylidene]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.