CAS 869478-10-4
:8-(2-Chloroacetyl)-6-(phenylmethoxy)-2H-1,4-benzoxazin-3(4H)-one
Description:
8-(2-Chloroacetyl)-6-(phenylmethoxy)-2H-1,4-benzoxazin-3(4H)-one is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine core. This compound features a chloroacetyl group and a phenylmethoxy substituent, contributing to its unique chemical properties. The presence of the chloroacetyl moiety suggests potential reactivity, particularly in nucleophilic substitution reactions. The benzoxazine framework is known for its stability and potential applications in materials science, particularly in the development of polymers and coatings. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and reactivity. Overall, this compound represents a class of benzoxazine derivatives that may have diverse applications in both industrial and pharmaceutical contexts.
Formula:C17H14ClNO4
InChI:InChI=1S/C17H14ClNO4/c18-8-15(20)13-6-12(22-9-11-4-2-1-3-5-11)7-14-17(13)23-10-16(21)19-14/h1-7H,8-10H2,(H,19,21)
InChI key:InChIKey=MNBYEYMYIRMHCK-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=C2C(=CC(OCC3=CC=CC=C3)=C1)NC(=O)CO2
Synonyms:- 6-Benzyloxy-8-(chloroacetyl)-4H-benzo[1,4]oxazin-3-one
- 8-(2-Chloroacetyl)-6-(phenylmethoxy)-2H-1,4-benzoxazin-3(4H)-one
- 2H-1,4-Benzoxazin-3(4H)-one, 8-(chloroacetyl)-6-(phenylmethoxy)-
- 2H-1,4-Benzoxazin-3(4H)-one, 8-(2-chloroacetyl)-6-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
