CAS 869488-99-3: 1-benzhydryl-3-fluoro-azetidine hydrochloride

Description:1-Benzhydryl-3-fluoro-azetidine hydrochloride is a chemical compound characterized by its unique structural features, including a four-membered azetidine ring, a benzhydryl group, and a fluorine atom. The presence of the azetidine ring contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. The benzhydryl moiety enhances lipophilicity, which can influence the compound's bioavailability and interaction with biological targets. The fluorine atom is known to modify the electronic properties of the molecule, potentially affecting its reactivity and pharmacological profile. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including drug formulation. The compound's specific characteristics, such as melting point, solubility, and stability, would depend on its molecular interactions and the conditions under which it is studied. Overall, 1-benzhydryl-3-fluoro-azetidine hydrochloride represents a compound of interest in the field of organic and medicinal chemistry, warranting further investigation for its potential therapeutic applications.

Formula:C₁₆H₁₇ClFN

InChI:InChI=1/C16H16FN.ClH/c17-15-11-18(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;/h1-10,15-16H,11-12H2;1H

Synonyms:
1-(Diphenylmethyl)-3-fluoroazetidine hydrochloride (1:1)
Azetidine, 1-(diphenylmethyl)-3-fluoro-, hydrochloride (1:1)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1-Benzhydryl-3-fluoro-azetidine hydrochloride REF: 10-F024764CAS: 869488-99-3	98.0%	206.00 €~528.00 €	Wed 30 Apr 25
1-BENZHYDRYL-3-FLUORO-AZETIDINE HYDROCHLORIDE REF: IN-DA00GT25CAS: 869488-99-3	- - -	To inquire	Tue 06 May 25
1-Benzhydryl-3-fluoro-azetidine hydrochloride REF: 3D-UJB48899CAS: 869488-99-3	Min. 95%	- - -	Discontinued product