CymitQuimica logo

CAS 869493-49-2

:

4-(Trifluoromethyl)-1-piperidinepropanamine

Description:
4-(Trifluoromethyl)-1-piperidinepropanamine, identified by its CAS number 869493-49-2, is a chemical compound characterized by its unique structure that includes a piperidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may contribute to its biological activity, making it of interest in medicinal chemistry. Additionally, the piperidine moiety is known for its role in various pharmacological applications, often serving as a scaffold for drug development. The compound's stability, reactivity, and potential applications can vary based on its specific functional groups and the overall molecular architecture. As with many fluorinated compounds, it may exhibit unique interactions with biological systems, which can be explored further in research contexts. Safety and handling considerations should be taken into account due to the potential toxicity associated with certain amines and fluorinated compounds.
Formula:C9H17F3N2
InChI:InChI=1S/C9H17F3N2/c10-9(11,12)8-2-6-14(7-3-8)5-1-4-13/h8H,1-7,13H2
InChI key:InChIKey=LXBHHKCLIVEIKK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1CCN(CCCN)CC1
Synonyms:
  • 3-[4-(Trifluoromethyl)piperidin-1-yl]propan-1-amine
  • 4-(Trifluoromethyl)-1-piperidinepropanamine
  • 1-Piperidinepropanamine, 4-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.