CymitQuimica logo

CAS 869496-60-6

:

3-(3-chlorophenyl)isoxazole-5-carbaldehyde

Description:
3-(3-Chlorophenyl)isoxazole-5-carbaldehyde is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a chlorophenyl group indicates that there is a chlorine atom attached to a phenyl ring at the meta position relative to the isoxazole. The aldehyde functional group (-CHO) at the 5-position of the isoxazole contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with biological targets, and it may serve as a building block for synthesizing more complex molecules. Additionally, the compound's physical properties, such as solubility and melting point, would depend on its molecular interactions and the presence of functional groups. Overall, 3-(3-chlorophenyl)isoxazole-5-carbaldehyde is a versatile compound with applications in organic synthesis and pharmaceutical research.
Formula:C10H6ClNO2
InChI:InChI=1/C10H6ClNO2/c11-8-3-1-2-7(4-8)10-5-9(6-13)14-12-10/h1-6H
SMILES:c1cc(cc(c1)Cl)c1cc(C=O)on1
Synonyms:
  • 3-(3-Chlorophenyl)-1,2-oxazole-5-carbaldehyde
  • 5-Isoxazolecarboxaldehyde, 3-(3-Chlorophenyl)-
  • 3-(3-chlorophenyl)-5-Isoxazolecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.