CAS 869496-61-7
:3-(2-Bromophenyl)-5-isoxazolecarboxaldehyde
Description:
3-(2-Bromophenyl)-5-isoxazolecarboxaldehyde is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromophenyl group indicates that a bromine atom is substituted on a phenyl ring, contributing to the compound's reactivity and potential biological activity. The aldehyde functional group (-CHO) at the 5-position of the isoxazole ring is significant for its chemical reactivity, allowing for various reactions such as condensation and nucleophilic addition. This compound may exhibit properties such as fluorescence or photochemical activity, depending on its molecular structure and substituents. It is often utilized in synthetic organic chemistry and may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C10H6BrNO2
InChI:InChI=1S/C10H6BrNO2/c11-9-4-2-1-3-8(9)10-5-7(6-13)14-12-10/h1-6H
InChI key:InChIKey=MVRUSNXIULISNP-UHFFFAOYSA-N
SMILES:BrC1=C(C=2C=C(C=O)ON2)C=CC=C1
Synonyms:- 3-(2-Bromo-Phenyl)-Isoxazole-5-Carbaldehyde
- 3-(2-Bromophenyl)-5-isoxazolecarboxaldehyde
- 5-Isoxazolecarboxaldehyde, 3-(2-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
