CAS 869497-75-6: 6-chloro-2-[(4-methylpiperazin-1-yl)carbonyl]-1H-benzimidazole (2Z)-but-2-enedioate
Description:6-Chloro-2-[(4-methylpiperazin-1-yl)carbonyl]-1H-benzimidazole (2Z)-but-2-enedioate is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a chloro group and a piperazine moiety. The presence of the 4-methylpiperazine group suggests potential for interaction with biological targets, making it of interest in medicinal chemistry. The but-2-enedioate moiety indicates that it may participate in various chemical reactions, including esterification or conjugation. This compound is likely to exhibit properties typical of benzimidazole derivatives, such as potential antimicrobial or anticancer activities, although specific biological activities would depend on further empirical studies. Its solubility, stability, and reactivity can be influenced by the functional groups present, particularly the chloro and carbonyl groups. As with many synthetic organic compounds, safety and handling precautions should be observed, given the potential for toxicity associated with certain structural features. Overall, this compound represents a class of molecules that may have significant pharmacological relevance.
Formula:C17H19ClN4O5
InChI:InChI=1/C13H15ClN4O.C4H4O4/c1-17-4-6-18(7-5-17)13(19)12-15-10-3-2-9(14)8-11(10)16-12;5-3(6)1-2-4(7)8/h2-3,8H,4-7H2,1H3,(H,15,16);1-2H,(H,5,6)(H,7,8)/b;2-1-
![6-chloro-2-[(4-methylpiperazin-1-yl)carbonyl]-1H-benzimidazole (2Z)-but-2-enedioate](https://static.cymitquimica.com/cas-image/347207-6-chloro-2-4-methylpiperazin-1-yl-carbonyl-1h-benzimidazole-2z-but-2-enedioate.png)
![1-[(5-CHLORO-1H-BENZIMIDAZOL-2-YL)CARBONYL]-4-METHYLPIPERAZINE MALEATE](https://static.cymitquimica.com/products/IN/thumb/DA004O7A.jpg)
