
CAS 86953-80-2
:1-Pyrrolidinecarboxylic acid, 2-hydroxy-, methyl ester
Description:
1-Pyrrolidinecarboxylic acid, 2-hydroxy-, methyl ester, with the CAS number 86953-80-2, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The presence of a hydroxyl group at the 2-position of the pyrrolidine ring contributes to its polarity and potential for hydrogen bonding, influencing its solubility in polar solvents. Typically, such compounds exhibit moderate to high reactivity due to the functional groups present, making them useful in various chemical syntheses and applications. The compound may also exhibit biological activity, as many pyrrolidine derivatives are known for their pharmacological properties. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, this compound is of interest in both synthetic organic chemistry and potential medicinal applications.
Formula:C6H11NO3
InChI:InChI=1S/C6H11NO3/c1-10-6(9)7-4-2-3-5(7)8/h5,8H,2-4H2,1H3
InChI key:InChIKey=DHAOGLZIEUYIAD-UHFFFAOYSA-N
SMILES:C(OC)(=O)N1C(O)CCC1
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-hydroxy-, methyl ester
- Methyl 2-hydroxy-1-pyrrolidinecarboxylate
- 2-Hydroxy-1-pyrrolidinecarboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.