
CAS 869532-50-3
:rel-(3R,4S)-3,4-Difluoropyrrolidine
Description:
Rel-(3R,4S)-3,4-Difluoropyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered cyclic amine. The presence of two fluorine atoms at the 3 and 4 positions of the ring significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its chirality, indicated by the (3R,4S) configuration, suggests that it exists as a specific stereoisomer, which can have distinct biological activities compared to its enantiomers. Rel-(3R,4S)-3,4-Difluoropyrrolidine is of interest in medicinal chemistry and drug development, particularly for its potential applications in synthesizing pharmaceuticals. The fluorine substituents can enhance metabolic stability and alter the lipophilicity of the compound, making it a valuable building block in the design of new therapeutic agents. As with many fluorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C4H7F2N
InChI:InChI=1/C4H7F2N/c5-3-1-7-2-4(3)6/h3-4,7H,1-2H2/t3-,4+
InChI key:InChIKey=PHFTVEADDMICLE-ZXZARUISNA-N
SMILES:F[C@H]1[C@@H](F)CNC1
Synonyms:- (3R*,4S*)-3,4-Difluoropyrrolidine
- Pyrrolidine, 3,4-difluoro-, (3R,4S)-rel-
- cis-3,4-Difluoropyrrolidine
- rel-(3R,4S)-3,4-Difluoropyrrolidine
- Pyrrolidine, 3,4-difluoro-, (3R,4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.