CAS 869567-91-9
:1-(2-amino-3-pyridyl)ethanol
Description:
1-(2-amino-3-pyridyl)ethanol, with the CAS number 869567-91-9, is an organic compound characterized by its pyridine ring structure, which is substituted with an amino group and a hydroxyl group. This compound features a two-carbon ethanol chain linked to a pyridine ring at the 2-position, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of both the amino and hydroxyl functional groups makes it a polar molecule, enhancing its solubility in water and other polar solvents. This compound may exhibit biological activity, potentially serving as a building block in pharmaceuticals or agrochemicals. Its reactivity can be attributed to the amino group, which can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, the pyridine moiety can engage in hydrogen bonding and π-π interactions, influencing its behavior in biological systems and chemical environments. Overall, 1-(2-amino-3-pyridyl)ethanol is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C7H10N2O
InChI:InChI=1/C7H10N2O/c1-5(10)6-3-2-4-9-7(6)8/h2-5,10H,1H3,(H2,8,9)
Synonyms:- 3-pyridinemethanol, 2-amino-α-methyl-
- 1-(2-aminopyridin-3-yl)ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
