CAS 869577-53-7
:N-[4-[4-[(2-Thiiranylmethyl)sulfonyl]phenoxy]phenyl]methanesulfonamide
Description:
N-[4-[4-[(2-Thiiranylmethyl)sulfonyl]phenoxy]phenyl]methanesulfonamide, with the CAS number 869577-53-7, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups. This compound features a sulfonamide group, which is known for its biological activity, particularly in medicinal chemistry. The presence of a thiirane (or oxirane) moiety indicates potential reactivity and unique properties due to the strained ring structure. The phenoxy and phenyl groups contribute to the compound's hydrophobic characteristics, which can influence its solubility and interaction with biological targets. Additionally, the sulfonyl group enhances the compound's polarity, potentially affecting its pharmacokinetics. Overall, this compound may exhibit interesting biological activities, making it a candidate for further research in drug development or other applications in chemistry and biochemistry. However, specific data regarding its efficacy, safety, and applications would require detailed experimental studies and literature review.
Formula:C16H17NO5S3
InChI:InChI=1S/C16H17NO5S3/c1-24(18,19)17-12-2-4-13(5-3-12)22-14-6-8-16(9-7-14)25(20,21)11-15-10-23-15/h2-9,15,17H,10-11H2,1H3
InChI key:InChIKey=PHMPGOJWLISPFK-UHFFFAOYSA-N
SMILES:O(C1=CC=C(S(CC2CS2)(=O)=O)C=C1)C3=CC=C(NS(C)(=O)=O)C=C3
Synonyms:- Methanesulfonamide, N-[4-[4-[(thiiranylmethyl)sulfonyl]phenoxy]phenyl]-
- N-[4-[4-[(2-Thiiranylmethyl)sulfonyl]phenoxy]phenyl]methanesulfonamide
- Methanesulfonamide, N-[4-[4-[(2-thiiranylmethyl)sulfonyl]phenoxy]phenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
MMP-2/MMP-9 Inhibitor V
CAS:Matrix metalloproteinase (MMP) is a zinc-dependent enzyme that has been shown to be involved in cancer progression and metastasis. MMPs are involved in the degradation of extracellular matrix, which can lead to enhanced tumor cell invasion and metastasis. The inhibition of MMPs may therefore have therapeutic potential for preventing cancer progression and metastasis. The MMP-2/MMP-9 inhibitor V is a compound that inhibits both MMP-2 and MMP-9 activity. It has been shown to inhibit tumor growth in vivo by reducing the number of reactive stromal cells, which release cytokines that promote tumor growth. This drug also inhibits cancer cell migration and invasion, as well as angiogenesis.Formula:C16H17NO5S2Purity:Min. 95%Molecular weight:367.44 g/mol
