CAS 869631-11-8
:1-(cyclohexoxycarbonyloxy)ethyl 2-oxo-3-[[4-[2-(1H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate
Description:
1-(Cyclohexoxycarbonyloxy)ethyl 2-oxo-3-[[4-[2-(1H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate, with CAS number 869631-11-8, is a complex organic compound characterized by its multi-functional structure. It features a benzimidazole core, which is known for its biological activity, particularly in medicinal chemistry. The presence of a cyclohexoxycarbonyl group suggests potential lipophilicity, enhancing its ability to penetrate biological membranes. The compound also contains a tetrazole moiety, which is often associated with pharmacological properties, including anti-inflammatory and anti-cancer activities. The ester functional group in the molecule may influence its solubility and reactivity. Overall, this compound's unique structural features may contribute to its potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its biological activity would need to be evaluated through rigorous testing in relevant assays.
Formula:C31H30N6O6
InChI:InChI=1/C31H30N6O6/c1-19(42-31(40)43-22-8-3-2-4-9-22)41-29(38)25-12-7-13-26-27(25)37(30(39)32-26)18-20-14-16-21(17-15-20)23-10-5-6-11-24(23)28-33-35-36-34-28/h5-7,10-17,19,22H,2-4,8-9,18H2,1H3,(H,32,39)(H,33,34,35,36)
SMILES:CC(OC(=O)c1cccc2c1n(Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)c(n2)O)OC(=O)OC1CCCCC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Candesartan Cilexetil Related Compound B (1-{[(Cyclohexyloxy)carbonyl]oxy}ethyl 3-({2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl}methyl)-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylate)
CAS:Heterocyclic compounds with nitrogen hetero-atom(s) only, aromatic or modified aromatic, nesoiFormula:C31H30N6O6Color and Shape:White PowderMolecular weight:582.22268O-Desethyl Candesartan Cilexetil
CAS:Formula:C31H30N6O6Purity:95%Color and Shape:SolidMolecular weight:582.6065Candesartan Cilexetil EP Impurity B (Candesartan Cilexetil USP Related Compound B, Desethyl Candesartan Cilexetil)
CAS:Formula:C31H30N6O6Color and Shape:White To Off-White SolidMolecular weight:582.62O-Desethyl Candesartan Cilexetil
CAS:Controlled Product<p>Impurity Candesartan Cilexetil EP Impurity B<br>Applications O-Desethyl Candesartan Cilexetil (Candesartan Cilexetil EP Impurity B) is used for the preparation of Candesartan cilexetil.<br>References Lu, R., et al.: Tetrahedr. Lett., 41, 2817 (2000),<br></p>Formula:C31H30N6O6Color and Shape:NeatMolecular weight:582.61






