CymitQuimica logo

CAS 86964-20-7

:

2-[(4,6-Dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid

Description:
2-[(4,6-Dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid, with the CAS number 86964-20-7, is a chemical compound characterized by its sulfonic acid functional group and a triazine moiety. This compound features a dichlorinated triazine ring, which contributes to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. The presence of the sulfonic acid group enhances its solubility in water, making it suitable for use in aqueous formulations. Additionally, the triazine structure is known for its stability and ability to form complexes with metal ions, which can be advantageous in certain chemical reactions. The compound may exhibit biological activity, potentially serving as a herbicide or in other agrochemical applications. Its synthesis typically involves multi-step organic reactions, and it is important to handle it with care due to the presence of chlorine atoms, which can pose environmental and health risks. Overall, this compound is of interest for its unique structural features and potential utility in various chemical applications.
Formula:C9H6Cl2N4O3S
InChI:InChI=1S/C9H6Cl2N4O3S/c10-7-13-8(11)15-9(14-7)12-5-3-1-2-4-6(5)19(16,17)18/h1-4H,(H,16,17,18)(H,12,13,14,15)
InChI key:InChIKey=ZWAHIPWUVJWJJD-UHFFFAOYSA-N
SMILES:N(C1=C(S(=O)(=O)O)C=CC=C1)C=2N=C(Cl)N=C(Cl)N2
Synonyms:
  • 2-[(4,6-Dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid
  • 2-(4,6-Dichloro-2-triazinylamino)benzenesulfonic acid
  • Benzenesulfonic acid, 2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.