CAS 869716-06-3

N-(2-Acetylphenyl)-4-chlorobutanamide

Description:

N-(2-Acetylphenyl)-4-chlorobutanamide, identified by its CAS number 869716-06-3, is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a 4-chlorobutanamide structure, indicating the presence of a chlorine atom on the butanamide chain, and an acetylphenyl group that contributes to its aromatic character. The presence of the acetyl group suggests potential reactivity in various chemical transformations, while the chlorobutane moiety may influence its solubility and biological activity. Typically, compounds like this may exhibit properties such as moderate to high melting points, depending on their molecular interactions, and may be soluble in organic solvents. The specific applications and biological activities of N-(2-Acetylphenyl)-4-chlorobutanamide would depend on its structural characteristics, making it of interest in fields such as medicinal chemistry and materials science. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₂H₁₄ClNO₂

InChI: InChI=1S/C12H14ClNO2/c1-9(15)10-5-2-3-6-11(10)14-12(16)7-4-8-13/h2-3,5-6H,4,7-8H2,1H3,(H,14,16)

InChI key: InChIKey=RZVSAGPFKZLLTR-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(NC(CCCCl)=O)C=CC=C1

Synonyms:

• N-(2-Acetylphenyl)-4-chlorobutanamide
• Butanamide, N-(2-acetylphenyl)-4-chloro-