CAS 869725-53-1
:2-Bromo-5-(trifluoromethyl)benzyl alcohol
Description:
2-Bromo-5-(trifluoromethyl)benzyl alcohol is an organic compound characterized by its unique functional groups and structural features. It contains a bromine atom and a trifluoromethyl group attached to a benzyl alcohol moiety, which contributes to its reactivity and physical properties. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The trifluoromethyl group is known for imparting lipophilicity and influencing the compound's biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, and its solubility in water is limited due to the hydrophobic nature of the trifluoromethyl group. 2-Bromo-5-(trifluoromethyl)benzyl alcohol may be utilized in pharmaceutical research, agrochemical development, and as an intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C8H6BrF3O
InChI:InChI=1/C8H6BrF3O/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-3,13H,4H2
SMILES:c1cc(c(cc1C(F)(F)F)CO)Br
Synonyms:- [2-Bromo-5-(trifluoromethyl)phenyl]methanol
- Benzenemethanol, 2-bromo-5-(trifluoromethyl)-
- 2-Bromo-5-Trilfuoromethylbenzyl Alcohol
- 2-Bromo-5-trifluoromethylbenzyl alcohol
- 4-Bromo-3-(hydroxymethyl)benzotrifluoride
- 4-Bromo-3-(hydroxymethyl)benzotrifluoride, [2-Bromo-5-(trifluoromethyl)phenyl]methanol
- 2-Bromo-5-(trifluoromethyl)ben
- 2-BROMO-5-(TRIFLUOROMETHYL)BENZYL ALCOHOL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2-Bromo-5-(trifluoromethyl)phenyl)methanol
CAS:Formula:C8H6BrF3OPurity:97%Color and Shape:SolidMolecular weight:255.0318Ref: IN-DA008E6Z
1g28.00€5g70.00€10g107.00€1kgTo inquire25g210.00€100g560.00€500gTo inquire250mg24.00€2-Bromo-5-(trifluoromethyl)benzyl alcohol
CAS:2-Bromo-5-(trifluoromethyl)benzyl alcoholFormula:C8H6BrF3OPurity:≥95%Color and Shape: faint yellow crystalline needlesMolecular weight:255.03g/mol2-Bromo-5-(trifluoromethyl)benzyl alcohol
CAS:2-Bromo-5-(trifluoromethyl)benzyl alcohol is a fine chemical that is used as an intermediate in the synthesis of other chemicals. It can be used to synthesize novel organic compounds, such as pharmaceuticals and pesticides. This chemical has been shown to react with various other organic compounds, including amines, thiols, and carboxylic acids. 2-Bromo-5-(trifluoromethyl)benzyl alcohol is also known for its ability to form complexes with metals.Formula:C8H6BrF3OPurity:Min. 95%Molecular weight:255.03 g/mol2-Bromo-5-(trifluoromethyl)benzyl alcohol
CAS:Formula:C8H6BrF3OPurity:97%Color and Shape:SolidMolecular weight:255.034



