CAS 869725-76-8

[(5-bromo-2,3-dihydro-1H-inden-1-yl)oxy](tert-butyl)dimethylsilane

Description:

The chemical substance known as "[(5-bromo-2,3-dihydro-1H-inden-1-yl)oxy](tert-butyl)dimethylsilane," with the CAS number 869725-76-8, is an organosilicon compound characterized by the presence of a brominated indene derivative and a tert-butyl dimethylsilyl group. This compound features a unique structure that combines a bromine atom, which can enhance reactivity and facilitate further chemical transformations, with a silane moiety that provides stability and potential for various applications in organic synthesis. The presence of the tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and solubility. Additionally, the dimethylsilane group imparts hydrophobic characteristics, making the compound suitable for use in various chemical reactions, including coupling reactions and as a protecting group in organic synthesis. Overall, this compound exemplifies the versatility of organosilicon chemistry, with potential applications in pharmaceuticals, materials science, and catalysis.

Formula: C₁₅H₂₃BrOSi

InChI: InChI=1/C15H23BrOSi/c1-15(2,3)18(4,5)17-14-9-6-11-10-12(16)7-8-13(11)14/h7-8,10,14H,6,9H2,1-5H3

SMILES: CC(C)(C)[Si](C)(C)OC1CCc2cc(ccc12)Br