CAS 869735-24-0
:N-[4-(1,3-Dioxolan-2-yl)-3-pyridinyl]-2,2-dimethylpropanamide
Description:
N-[4-(1,3-Dioxolan-2-yl)-3-pyridinyl]-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring and a dioxolane moiety. This compound is classified as an amide due to the presence of the amide functional group (-C(=O)N-). The dioxolane ring contributes to its potential solubility in polar solvents, while the dimethylpropanamide structure may influence its lipophilicity and biological activity. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its specific interactions with biological targets would depend on the spatial arrangement of its functional groups, which can affect binding affinity and selectivity. Additionally, the presence of heteroatoms such as nitrogen and oxygen in its structure may enhance its reactivity and stability under various conditions. Overall, this compound's unique characteristics make it a subject of interest for further investigation in chemical and pharmaceutical applications.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c1-13(2,3)12(16)15-10-8-14-5-4-9(10)11-17-6-7-18-11/h4-5,8,11H,6-7H2,1-3H3,(H,15,16)
InChI key:InChIKey=KURMNELUHRJXTB-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C(=CC=NC1)C2OCCO2
Synonyms:- N-[4-(1,3-Dioxolan-2-yl)-3-pyridinyl]-2,2-dimethylpropanamide
- Propanamide, N-[4-(1,3-dioxolan-2-yl)-3-pyridinyl]-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(4-[1,3]Dioxolan-2-yl-pyridin-3-yl)-2,2-dimethyl-propionamide
CAS:Formula:C13H18N2O3Molecular weight:250.2936
