CAS 86977-19-7

2'-deoxy-5-fluoro-3'-C-octanoyluridine

Description:

2'-Deoxy-5-fluoro-3'-C-octanoyluridine is a modified nucleoside that features a uridine base with specific chemical modifications. The presence of a 5-fluoro group enhances its potential as an antiviral agent, particularly in the context of nucleoside analogs used in therapeutic applications. The 3'-C-octanoyl modification introduces a fatty acid chain, which can influence the compound's lipophilicity and membrane permeability, potentially enhancing its bioavailability and cellular uptake. This compound is of interest in medicinal chemistry and pharmacology, particularly for its role in nucleoside analog development. Its CAS number, 86977-19-7, allows for precise identification in chemical databases. As a nucleoside analog, it may exhibit antiviral properties by interfering with viral replication processes. The structural modifications contribute to its unique pharmacological profile, making it a subject of research in the development of new antiviral therapies. Overall, 2'-deoxy-5-fluoro-3'-C-octanoyluridine represents a significant advancement in the design of nucleoside-based drugs.

Formula: C₁₇H₂₅FN₂O₆

InChI: InChI=1/C17H25FN2O6/c1-2-3-4-5-6-7-12(22)17(25)8-14(26-13(17)10-21)20-9-11(18)15(23)19-16(20)24/h9,13-14,21,25H,2-8,10H2,1H3,(H,19,23,24)/t13-,14-,17-/m1/s1

SMILES: CCCCCCCC(=O)[C@@]1(C[C@H](n2cc(c(nc2=O)O)F)O[C@@H]1CO)O