CAS 86979-66-0

4-azido-2-hydroxy-N-[[(3S,4S,5S,6R)-3,4,5,6-tetrahydroxytetrahydropyran-2-yl]methyl]benzamide

Description:

4-Azido-2-hydroxy-N-[[(3S,4S,5S,6R)-3,4,5,6-tetrahydroxytetrahydropyran-2-yl]methyl]benzamide is a complex organic compound characterized by the presence of an azido group (-N3), a hydroxyl group (-OH), and a benzamide moiety. The compound features a tetrahydroxytetrahydropyran structure, which contributes to its potential biological activity and solubility properties. The azido group is known for its reactivity, particularly in click chemistry, making this compound potentially useful in bioconjugation and drug development. The hydroxyl groups enhance its polarity, which may influence its interaction with biological systems and solubility in aqueous environments. The stereochemistry of the tetrahydroxytetrahydropyran ring indicates specific spatial arrangements that can affect the compound's biological interactions and pharmacokinetics. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science, particularly in the development of targeted therapies or as a building block in synthetic organic chemistry.

Formula: C₁₃H₁₆N₄O₇

InChI: InChI=1/C13H16N4O7/c14-17-16-5-1-2-6(7(18)3-5)12(22)15-4-8-9(19)10(20)11(21)13(23)24-8/h1-3,8-11,13,18-21,23H,4H2,(H,15,22)/t8?,9-,10+,11+,13-/m1/s1