CAS 869846-78-6

1H-Imidazole-2-propanoic acid, 1-methyl-, hydrochloride (1:1)

Description:

1H-Imidazole-2-propanoic acid, 1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance is typically a white to off-white crystalline powder and is soluble in water, indicating its ionic nature due to the presence of the hydrochloride salt form. The imidazole moiety contributes to its potential biological activity, making it relevant in pharmaceutical applications, particularly in the development of drugs that target various biological pathways. The presence of the propanoic acid side chain may enhance its solubility and bioavailability. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit properties such as being a zwitterion, depending on the pH of the solution, which can influence its interaction with biological systems. Overall, its unique structure and properties make it a subject of interest in medicinal chemistry and related fields.

Formula: C₇H₁₀N₂O₂·ClH

InChI: InChI=1S/C7H10N2O2.ClH/c1-9-5-4-8-6(9)2-3-7(10)11;/h4-5H,2-3H2,1H3,(H,10,11);1H

InChI key: InChIKey=UUTISYUINAELJD-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1N(C)C=CN1.Cl

Synonyms:

• 1H-Imidazole-2-propanoic acid, 1-methyl-, hydrochloride (1:1)
• 1H-Imidazole-2-propanoic acid, 1-methyl-, monohydrochloride
• 3-(1-Methyl-1H-imidazol-2-yl)propanoic acid hydrochloride

3-(1-Methyl-1H-imidazol-2-yl)propanoic acid hydrochloride

CAS: 869846-78-6

Versatile small molecule scaffold

Formula: C₇H₁₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 190.63 g/mol

Ref: 3D-UJB84678