
CAS 869852-15-3
:1-(6-Chloro-3-methoxy-4-pyridazinyl)ethanone
Description:
1-(6-Chloro-3-methoxy-4-pyridazinyl)ethanone is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chloro group at the 6-position and a methoxy group at the 3-position contributes to its unique reactivity and potential biological activity. The ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its chemical behavior, particularly in reactions involving nucleophiles. This compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Its structural features suggest that it could be explored for applications in pharmaceuticals or agrochemicals. As with many heterocyclic compounds, the specific characteristics, including stability and reactivity, can be influenced by the substituents on the pyridazine ring, which may affect its electronic properties and steric hindrance.
Formula:C7H7ClN2O2
InChI:InChI=1S/C7H7ClN2O2/c1-4(11)5-3-6(8)9-10-7(5)12-2/h3H,1-2H3
InChI key:InChIKey=VXLCINMWUKLJOC-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(OC)N=NC(Cl)=C1
Synonyms:- 1-(6-Chloro-3-methoxypyridazin-4-yl)ethanone
- 1-(6-Chloro-3-methoxy-4-pyridazinyl)ethanone
- Ethanone, 1-(6-chloro-3-methoxy-4-pyridazinyl)-
- 1-(6-Chloro-3-methoxypyridazin-4-yl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.