CAS 869853-73-6
:ethyl 2,2-dimethyl-3-(4-sulfanylphenyl)propanoate
Description:
Ethyl 2,2-dimethyl-3-(4-sulfanylphenyl)propanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid. This compound features a propanoate backbone with two methyl groups at the second carbon and a para-substituted phenyl group containing a thiol (-SH) group at the fourth position. The presence of the thiol group imparts unique reactivity and properties, such as potential for forming disulfide bonds and participating in redox reactions. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests moderate lipophilicity, which may influence its solubility in organic solvents. Ethyl 2,2-dimethyl-3-(4-sulfanylphenyl)propanoate may have applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. However, specific safety and handling information should be consulted due to the presence of the thiol group, which can be reactive and may have implications for toxicity.
Formula:C13H18O2S
InChI:InChI=1/C13H18O2S/c1-4-15-12(14)13(2,3)9-10-5-7-11(16)8-6-10/h5-8,16H,4,9H2,1-3H3
SMILES:CCOC(=O)C(C)(C)Cc1ccc(cc1)S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2,2-Dimethyl-3-(4-mercaptophenyl)propionate
CAS:Controlled ProductApplications Ethyl 2,2-Dimethyl-3-(4-mercaptophenyl)propionate (cas# 869853-73-6) is a compound useful in organic synthesis.
Formula:C13H18O2SColor and Shape:NeatMolecular weight:238.35
