CymitQuimica logo

CAS 869882-72-4

:

4-Amino-N-[(phenylmethoxy)carbonyl]-L-phenylalanine 1,1-dimethylethyl ester

Description:
4-Amino-N-[(phenylmethoxy)carbonyl]-L-phenylalanine 1,1-dimethylethyl ester, identified by its CAS number 869882-72-4, is a synthetic amino acid derivative that features a phenylmethoxycarbonyl group and a tert-butyl ester. This compound is characterized by its amino group, which contributes to its basicity and potential reactivity in peptide synthesis. The presence of the phenylmethoxy group enhances its lipophilicity, making it suitable for various biochemical applications, including drug design and development. The tert-butyl ester moiety provides stability and can influence the solubility and bioavailability of the compound. Additionally, this substance may exhibit specific stereochemistry due to the presence of the L-phenylalanine configuration, which is crucial for its biological activity. Overall, this compound is of interest in medicinal chemistry and biochemistry, particularly in the context of peptide synthesis and the development of pharmaceutical agents. Its unique structural features allow for potential interactions with biological targets, making it a valuable compound for research and application in drug discovery.
Formula:C21H26N2O4
InChI:InChI=1S/C21H26N2O4/c1-21(2,3)27-19(24)18(13-15-9-11-17(22)12-10-15)23-20(25)26-14-16-7-5-4-6-8-16/h4-12,18H,13-14,22H2,1-3H3,(H,23,25)/t18-/m0/s1
InChI key:InChIKey=PDVYBWWBCFHHFE-SFHVURJKSA-N
SMILES:[C@@H](CC1=CC=C(N)C=C1)(NC(OCC2=CC=CC=C2)=O)C(OC(C)(C)C)=O
Synonyms:
  • (S)-tert-Butyl 3-(4-aminophenyl)-2-(((benzyloxy)carbonyl)amino)propanoate
  • 4-Amino-N-[(phenylmethoxy)carbonyl]-L-phenylalanine 1,1-dimethylethyl ester
  • L-Phenylalanine, 4-amino-N-[(phenylmethoxy)carbonyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.