CAS 869884-00-4

(S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline D-(-)-tartrate

Description:

(S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline D-(-)-tartrate is a chiral compound that belongs to the class of isoquinoline derivatives. It features a tetrahydroisoquinoline core, which is a bicyclic structure that includes a nitrogen atom within its ring system. The presence of the phenyl group contributes to its aromatic characteristics, while the tartrate moiety indicates that it is a salt or ester derived from tartaric acid, which is often used to enhance solubility and stability. This compound is typically studied for its potential pharmacological properties, including its role in medicinal chemistry and drug development. Its chirality, denoted by the (S) configuration, suggests that it may exhibit specific biological activities that differ from its enantiomers. The CAS number 869884-00-4 uniquely identifies this substance in chemical databases, facilitating research and regulatory processes. Overall, this compound's structural features and stereochemistry make it a subject of interest in various fields, including organic synthesis and pharmacology.

Formula: C₁₉H₂₁NO₆

InChI: InChI=1/C15H15N.C4H6O6/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;5-1(3(7)8)2(6)4(9)10/h1-9,15-16H,10-11H2;1-2,5-6H,(H,7,8)(H,9,10)/t15-;1-,2-/m00/s1

SMILES: c1ccc(cc1)[C@H]1c2ccccc2CCN1.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O

Synonyms:

• (S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline (2S,3S)-2,3-dihydroxybutanedioate
• (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline 2,3-dihydroxybutanedioate (1:1)