CymitQuimica logo

CAS 869886-87-3

:

5-Chloro-4-iodo-N-(1-methylethyl)-2-pyridinamine

Description:
5-Chloro-4-iodo-N-(1-methylethyl)-2-pyridinamine, with the CAS number 869886-87-3, is a chemical compound that belongs to the class of pyridinamines. This substance features a pyridine ring substituted with a chlorine atom at the 5-position and an iodine atom at the 4-position, along with an isopropyl group attached to the nitrogen atom. The presence of halogen substituents often influences the compound's reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in various fields, including pharmaceuticals, where such compounds may exhibit antimicrobial or anticancer properties. Additionally, the compound's solubility, stability, and interaction with biological systems would be influenced by its functional groups and overall molecular geometry. As with many halogenated compounds, safety and environmental considerations are essential, particularly regarding their synthesis and disposal. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C8H10ClIN2
InChI:InChI=1S/C8H10ClIN2/c1-5(2)12-8-3-7(10)6(9)4-11-8/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=WLFMFNGQAVYODS-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=CC(I)=C(Cl)C=N1
Synonyms:
  • 5-Chloro-4-iodo-N-(1-methylethyl)-2-pyridinamine
  • 2-Pyridinamine, 5-chloro-4-iodo-N-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.