CAS 869901-14-4

5-(chloromethyl)-1-methyl-3-phenyl-1H-pyrazole

Description:

5-(Chloromethyl)-1-methyl-3-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a chloromethyl group at the 5-position enhances its reactivity, making it a potential intermediate in organic synthesis. The methyl group at the 1-position and the phenyl group at the 3-position contribute to its overall hydrophobic character and influence its solubility and stability in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various functionalization possibilities, which can lead to derivatives with tailored properties. Additionally, the compound's stability and reactivity can be affected by environmental factors such as temperature and pH. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental impact. Overall, 5-(chloromethyl)-1-methyl-3-phenyl-1H-pyrazole is a versatile compound with applications in research and industry.

Formula: C₁₁H₁₁ClN₂

InChI: InChI=1/C11H11ClN2/c1-14-10(8-12)7-11(13-14)9-5-3-2-4-6-9/h2-7H,8H2,1H3

SMILES: Cn1c(cc(c2ccccc2)n1)CCl

5-(Chloromethyl)-1-methyl-3-phenyl-1H-pyrazole

CAS: 869901-14-4

5-(Chloromethyl)-1-methyl-3-phenyl-1H-pyrazole

Purity: 95%

Molecular weight: 206.68g/mol

Ref: 54-OR1004209