CAS 869901-16-6
:5-(2-Furanyl)-N-methyl-2-thiophenemethanamine
Description:
5-(2-Furanyl)-N-methyl-2-thiophenemethanamine, with the CAS number 869901-16-6, is an organic compound that features a unique structure combining a furan ring and a thiophene moiety. This compound is characterized by its nitrogen-containing amine functional group, which contributes to its potential biological activity. The presence of the furan and thiophene rings suggests that it may exhibit interesting electronic properties and reactivity due to the conjugated systems within these heterocycles. Typically, compounds of this nature may be investigated for their pharmacological properties, including potential applications in medicinal chemistry. The methyl group attached to the nitrogen atom can influence the compound's lipophilicity and solubility, which are critical factors in drug design. Additionally, the compound's stability, reactivity, and interaction with biological targets would be of interest in research contexts. Overall, 5-(2-Furanyl)-N-methyl-2-thiophenemethanamine represents a class of compounds that may hold significance in various chemical and pharmaceutical applications.
Formula:C10H11NOS
InChI:InChI=1S/C10H11NOS/c1-11-7-8-4-5-10(13-8)9-3-2-6-12-9/h2-6,11H,7H2,1H3
InChI key:InChIKey=REBAUXOPYFOJIE-UHFFFAOYSA-N
SMILES:C(NC)C=1SC(=CC1)C2=CC=CO2
Synonyms:- 2-Thiophenemethanamine, 5-(2-furanyl)-N-methyl-
- 5-(2-Furanyl)-N-methyl-2-thiophenemethanamine
- N-{[5-(2-furyl)thien-2-yl]methyl}-N-methylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.