CAS 869901-18-8

N-methyl-1-(5-methyl-2-phenylfuran-3-yl)methanamine

Description:

N-methyl-1-(5-methyl-2-phenylfuran-3-yl)methanamine, with the CAS number 869901-18-8, is an organic compound characterized by its unique structure that includes a furan ring substituted with a phenyl group and a methyl group. This compound features a methanamine functional group, which contributes to its basicity and potential reactivity. The presence of the furan ring suggests that it may exhibit aromatic properties, while the methyl and phenyl substituents can influence its solubility, stability, and interaction with biological systems. Typically, compounds of this nature may be investigated for their potential applications in pharmaceuticals or as intermediates in organic synthesis due to their structural complexity. Additionally, the presence of nitrogen in the amine group may impart specific biological activities, making it a candidate for further research in medicinal chemistry. Overall, the characteristics of this compound highlight its potential utility in various chemical and biological contexts.

Formula: C₁₃H₁₅NO

InChI: InChI=1/C13H15NO/c1-10-8-12(9-14-2)13(15-10)11-6-4-3-5-7-11/h3-8,14H,9H2,1-2H3

SMILES: Cc1cc(CNC)c(c2ccccc2)o1

Synonyms:

• N-methyl-N-[(5-methyl-2-phenyl-3-furyl)methyl]amine

N-Methyl-1-(5-methyl-2-phenyl-3-furyl)methylamine 95%

CAS: 869901-18-8

N-Methyl-1-(5-methyl-2-phenyl-3-furyl)methylamine 95%

Purity: 95%

Ref: 54-OR8691