CAS 869901-70-2
:Carbamic acid, [(1S)-2-(ethylamino)-1-methylethyl]-, 1,1-dimethylethyl ester
Description:
Carbamic acid, [(1S)-2-(ethylamino)-1-methylethyl]-, 1,1-dimethylethyl ester, identified by CAS number 869901-70-2, is a chemical compound that belongs to the class of carbamates. This substance features a carbamic acid functional group, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N). The compound has a complex structure that includes an ethylamino group, contributing to its potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of the 1,1-dimethylethyl ester moiety suggests that it may exhibit properties related to steric hindrance, which can influence its reactivity and interactions with biological systems. As with many carbamates, it may have applications in pharmaceuticals or agrochemicals, but specific uses would depend on further research into its efficacy and safety profile. Proper handling and safety measures are essential due to the potential toxicity associated with carbamate compounds.
Formula:C10H22N2O2
InChI:InChI=1S/C10H22N2O2/c1-6-11-7-8(2)12-9(13)14-10(3,4)5/h8,11H,6-7H2,1-5H3,(H,12,13)/t8-/m0/s1
InChI key:InChIKey=VJRACYXJGFHJHI-QMMMGPOBSA-N
SMILES:N(C(OC(C)(C)C)=O)[C@H](CNCC)C
Synonyms:- Carbamic acid, [(1S)-2-(ethylamino)-1-methylethyl]-, 1,1-dimethylethyl ester
- tert-Butyl [(1S)-2-(ethylamino)-1-methylethyl]carbamate
- tert-Butyl (r)-(1-(ethylamino)propan-2-yl)carbamate
- Carbamic acid, [(1S)-2-(ethylamino)-1-methylethyl]-, 1,1-dimethylethyl ester (9CI)
- (R)-tert-butyl 1-(ethylamino)propan-2-ylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
