CAS 869939-83-3
:(δS)-δ-Amino-4-[[4-[[[2,4-dichloro-3-[[(2,4-dimethyl-8-quinolinyl)oxy]methyl]phenyl]sulfonyl]amino]tetrahydro-2H-pyran-4-yl]carbonyl]-N,N,N-trimethyl-ε-oxo-1-piperazinepentanaminium
Description:
The chemical substance known as (δS)-δ-Amino-4-[[4-[[[2,4-dichloro-3-[[(2,4-dimethyl-8-quinolinyl)oxy]methyl]phenyl]sulfonyl]amino]tetrahydro-2H-pyran-4-yl]carbonyl]-N,N,N-trimethyl-ε-oxo-1-piperazinepentanaminium, with the CAS number 869939-83-3, is a complex organic compound characterized by its intricate molecular structure. It features multiple functional groups, including amino, sulfonyl, and piperazine moieties, which contribute to its potential biological activity. The presence of a quinoline derivative suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The dichloro and dimethyl substitutions indicate that the compound may exhibit specific electronic and steric properties, influencing its reactivity and solubility. Additionally, the trimethyl and carbonyl groups enhance its polarity, which can affect its pharmacokinetic profile. Overall, this compound's unique characteristics may position it as a candidate for further research in drug development or therapeutic applications, although detailed studies would be necessary to elucidate its specific properties and potential uses.
Formula:C36H49Cl2N6O6S
InChI:InChI=1S/C36H49Cl2N6O6S/c1-24-22-25(2)40-33-26(24)8-6-10-30(33)50-23-27-28(37)11-12-31(32(27)38)51(47,48)41-36(13-20-49-21-14-36)35(46)43-17-15-42(16-18-43)34(45)29(39)9-7-19-44(3,4)5/h6,8,10-12,22,29,41H,7,9,13-21,23,39H2,1-5H3/q+1/t29-/m0/s1
InChI key:InChIKey=FQVSDHOWSLEEKJ-LJAQVGFWSA-N
SMILES:C(=O)(C1(NS(=O)(=O)C2=C(Cl)C(COC=3C4=C(C(C)=CC(C)=N4)C=CC3)=C(Cl)C=C2)CCOCC1)N5CCN(C([C@H](CCC[N+](C)(C)C)N)=O)CC5
Synonyms:- 1-Piperazinepentanaminium, δ-amino-4-[[4-[[[2,4-dichloro-3-[[(2,4-dimethyl-8-quinolinyl)oxy]methyl]phenyl]sulfonyl]amino]tetrahydro-2H-pyran-4-yl]carbonyl]-N,N,N-trimethyl-ε-oxo-, (δS)-
- (δS)-δ-Amino-4-[[4-[[[2,4-dichloro-3-[[(2,4-dimethyl-8-quinolinyl)oxy]methyl]phenyl]sulfonyl]amino]tetrahydro-2H-pyran-4-yl]carbonyl]-N,N,N-trimethyl-ε-oxo-1-piperazinepentanaminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Fasitibant
CAS:Fasitibant is a potent and selective nonpeptide kinin B2 receptor antagonist.Formula:C36H49Cl2N6O6SColor and Shape:SolidMolecular weight:764.78

