CAS 869941-57-1

3-Amino-1H-1,2,4-triazole-1-acetic acid

Description:

3-Amino-1H-1,2,4-triazole-1-acetic acid is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and an acetic acid moiety, contributing to its potential as a versatile building block in organic synthesis and pharmaceutical applications. The presence of the amino group suggests that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the carboxylic acid functionality may enable it to form salts or esters, enhancing its solubility and reactivity. The compound is of interest in the field of agrochemicals and pharmaceuticals, particularly for its potential biological activities, including antifungal and herbicidal properties. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in medicinal chemistry. As with many nitrogen-containing heterocycles, it may exhibit unique physical and chemical properties, such as stability under certain conditions and specific reactivity patterns.

Formula: C₄H₆N₄O₂

InChI: InChI=1S/C4H6N4O2/c5-4-6-2-8(7-4)1-3(9)10/h2H,1H2,(H2,5,7)(H,9,10)

InChI key: InChIKey=WNEPQGXFDUUWRF-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(N)N=C1

Synonyms:

• 3-Amino-1H-1,2,4-triazole-1-acetic acid
• 2-(3-Amino-1H-1,2,4-triazol-1-yl)acetic acid
• (3-Amino-1H-1,2,4-triazol-1-yl)acetic acid
• 1H-1,2,4-Triazole-1-acetic acid, 3-amino-