CAS 869941-84-4

2-{[(3-methylthiophen-2-yl)methyl]amino}ethanol

Description:

2-{[(3-methylthiophen-2-yl)methyl]amino}ethanol is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a methyl group and an aminoethanol moiety. This compound features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its potential biological activity and chemical reactivity. The presence of the amino group allows for hydrogen bonding and increases the compound's solubility in polar solvents, while the ethanol component enhances its reactivity and interaction with other chemical species. The methyl group on the thiophene ring can influence the electronic properties and steric hindrance, potentially affecting its pharmacological profile. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets. Its specific applications and effects would depend on further studies, including its synthesis, stability, and biological activity. Overall, 2-{[(3-methylthiophen-2-yl)methyl]amino}ethanol represents a class of compounds that could have diverse applications in pharmaceuticals and materials science.

Formula: C₈H₁₃NOS

InChI: InChI=1/C8H13NOS/c1-7-2-5-11-8(7)6-9-3-4-10/h2,5,9-10H,3-4,6H2,1H3

SMILES: Cc1ccsc1CNCCO

Synonyms:

• 2-{[(3-Methyl-2-thienyl)methyl]amino}ethanol
• Ethanol, 2-[[(3-Methyl-2-Thienyl)Methyl]Amino]-

2-[(3-Methyl-thiophen-2-ylmethyl)-amino]-ethanol

CAS: 869941-84-4

Formula: C₈H₁₃NOS

Purity: 95.0%

Molecular weight: 171.26

Ref: 10-F087173