CymitQuimica logo

CAS 869941-85-5

:

5-Ethyl-2,4-dihydro-4-propyl-3H-1,2,4-triazole-3-thione

Description:
5-Ethyl-2,4-dihydro-4-propyl-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The ethyl and propyl substituents on the triazole ring enhance its lipophilicity, potentially influencing its solubility and interaction with biological systems. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and agricultural applications. Its CAS number, 869941-85-5, allows for precise identification in chemical databases. As with many triazole derivatives, it may also possess antifungal or herbicidal properties, although specific applications would depend on further research and testing. Overall, the unique structural features of this compound suggest a diverse range of potential uses in various fields of chemistry and biology.
Formula:C7H13N3S
InChI:InChI=1S/C7H13N3S/c1-3-5-10-6(4-2)8-9-7(10)11/h3-5H2,1-2H3,(H,9,11)
InChI key:InChIKey=RJENIRVSJZXHDV-UHFFFAOYSA-N
SMILES:C(CC)N1C(CC)=NNC1=S
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 5-ethyl-2,4-dihydro-4-propyl-
  • 5-Ethyl-2,4-dihydro-4-propyl-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.