CAS 869942-00-7

2-methyl-N-(4-methylbenzyl)propan-1-amine

Description:

2-methyl-N-(4-methylbenzyl)propan-1-amine, with the CAS number 869942-00-7, is an organic compound characterized by its amine functional group, which is indicative of its potential as a base and nucleophile in chemical reactions. This compound features a branched alkyl chain, specifically a propan-1-amine structure, which contributes to its hydrophobic characteristics. The presence of a methyl group and a 4-methylbenzyl substituent enhances its steric bulk, potentially influencing its reactivity and interaction with biological systems. As an amine, it can participate in hydrogen bonding, affecting its solubility in polar solvents. The compound may exhibit basicity, allowing it to accept protons in acidic environments. Its structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. Safety and handling considerations should also be taken into account, as with any chemical substance.

Formula: C₁₂H₁₉N

InChI: InChI=1/C12H19N/c1-10(2)8-13-9-12-6-4-11(3)5-7-12/h4-7,10,13H,8-9H2,1-3H3

SMILES: CC(C)CNCc1ccc(C)cc1

Synonyms:

• benzenemethanamine, 4-methyl-N-(2-methylpropyl)-

2-methyl-N-(4-methylbenzyl)-1-propanamine hydrochloride

CAS: 869942-00-7

Formula: C₁₂H₂₀ClN

Purity: 95.0%

Molecular weight: 213.75

Ref: 10-F361653