CAS 869942-01-8

N-(4-methylbenzyl)butan-2-amine

Description:

N-(4-methylbenzyl)butan-2-amine, identified by its CAS number 869942-01-8, is an organic compound characterized by its amine functional group and a butane backbone. This substance features a butan-2-amine structure, where a 4-methylbenzyl group is attached to the nitrogen atom of the amine. The presence of the aromatic ring contributes to its hydrophobic characteristics, while the amine group imparts basic properties. Typically, compounds of this nature may exhibit moderate solubility in organic solvents and limited solubility in water due to their hydrophobic nature. The compound may participate in various chemical reactions typical of amines, such as alkylation and acylation, and can act as a ligand in coordination chemistry. Additionally, due to its structural features, it may have implications in medicinal chemistry, potentially influencing biological activity. Safety and handling precautions should be observed, as with all amines, due to potential irritant properties and the need for proper storage conditions to maintain stability.

Formula: C₁₂H₁₉N

InChI: InChI=1/C12H19N/c1-4-11(3)13-9-12-7-5-10(2)6-8-12/h5-8,11,13H,4,9H2,1-3H3

SMILES: CCC(C)NCc1ccc(C)cc1