CymitQuimica logo

CAS 869942-03-0

:

N-Pentyl-4-pyridinemethanamine

Description:
N-Pentyl-4-pyridinemethanamine, identified by its CAS number 869942-03-0, is an organic compound characterized by its structure, which includes a pyridine ring and a pentyl chain. This compound features a primary amine functional group, which contributes to its reactivity and potential interactions in various chemical environments. Typically, compounds of this nature exhibit moderate to high solubility in polar solvents due to the presence of the amine group, while the hydrophobic pentyl chain may enhance solubility in non-polar solvents. N-Pentyl-4-pyridinemethanamine may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or psychiatric conditions. Its molecular properties, such as boiling point, melting point, and specific reactivity, would depend on the precise arrangement of atoms and the presence of functional groups. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, N-Pentyl-4-pyridinemethanamine represents a class of compounds with diverse applications in medicinal chemistry and related fields.
Formula:C11H18N2
InChI:InChI=1S/C11H18N2/c1-2-3-4-7-13-10-11-5-8-12-9-6-11/h5-6,8-9,13H,2-4,7,10H2,1H3
InChI key:InChIKey=RDLQHIMCCDTGLA-UHFFFAOYSA-N
SMILES:C(NCCCCC)C=1C=CN=CC1
Synonyms:
  • 4-Pyridinemethanamine, N-pentyl-
  • N-Pentyl-4-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.