CAS 869942-15-4
:2-Methyl-2-[(4-pyridinylmethyl)amino]-1-propanol
Description:
2-Methyl-2-[(4-pyridinylmethyl)amino]-1-propanol, with the CAS number 869942-15-4, is a chemical compound characterized by its unique structure that includes a tertiary alcohol and a pyridine moiety. This compound features a central carbon atom bonded to a hydroxyl group, a methyl group, and a pyridinylmethylamino group, which contributes to its potential biological activity. The presence of the pyridine ring suggests that it may exhibit properties relevant to medicinal chemistry, possibly acting as a ligand or influencing biological pathways. The compound is likely to be soluble in polar solvents due to the hydroxyl group, while the pyridine ring may enhance its interaction with biological targets. Its molecular structure may allow for hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and potential applications. As with many organic compounds, the specific characteristics such as melting point, boiling point, and reactivity would depend on the conditions and environment in which it is studied.
Formula:C10H16N2O
InChI:InChI=1S/C10H16N2O/c1-10(2,8-13)12-7-9-3-5-11-6-4-9/h3-6,12-13H,7-8H2,1-2H3
InChI key:InChIKey=TZDUZQUTTIZESH-UHFFFAOYSA-N
SMILES:C(NC(CO)(C)C)C=1C=CN=CC1
Synonyms:- 1-Propanol, 2-Methyl-2-[(4-Pyridinylmethyl)Amino]-
- 2-Methyl-2-[(4-pyridinylmethyl)amino]-1-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.