CAS 869942-30-3

2-methyl-N-[(3-methylthiophen-2-yl)methyl]propan-1-amine

Description:

2-methyl-N-[(3-methylthiophen-2-yl)methyl]propan-1-amine, identified by its CAS number 869942-30-3, is a chemical compound that belongs to the class of amines. This substance features a branched alkyl chain, specifically a propan-1-amine structure, which is substituted with a methyl group and a thiophene derivative. The presence of the thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributes to the compound's unique properties, including potential biological activity. The methyl groups enhance lipophilicity, which may influence the compound's solubility and permeability in biological systems. As an amine, it may exhibit basic properties and can participate in various chemical reactions, such as alkylation or acylation. The compound's specific characteristics, including its melting point, boiling point, and reactivity, would depend on its molecular structure and the functional groups present. Overall, this compound may have applications in pharmaceuticals or materials science, although detailed studies would be necessary to fully understand its behavior and potential uses.

Formula: C₁₀H₁₇NS

InChI: InChI=1/C10H17NS/c1-8(2)6-11-7-10-9(3)4-5-12-10/h4-5,8,11H,6-7H2,1-3H3

SMILES: CC(C)CNCc1c(C)ccs1

2-methyl-N-[(3-methyl-2-thienyl)methyl]-1-propanamine hydrochloride

CAS: 869942-30-3

Formula: C₁₀H₁₈ClNS

Purity: 95.0%

Molecular weight: 219.77

Ref: 10-F361702