CAS 869942-33-6

5-(Acetylamino)-1H-1,2,4-triazole-3-acetic acid

Description:

5-(Acetylamino)-1H-1,2,4-triazole-3-acetic acid is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an acetylamino group, contributing to its potential as a bioactive molecule. The presence of the acetic acid moiety suggests it may exhibit acidic properties, influencing its solubility and reactivity in various environments. The compound's structure allows for potential interactions with biological systems, making it of interest in pharmaceutical research. Its CAS number, 869942-33-6, serves as a unique identifier for regulatory and safety information. Typically, compounds like this may be evaluated for their pharmacological activities, including antimicrobial or anti-inflammatory properties, although specific biological data would depend on empirical studies. Overall, the characteristics of this compound suggest it may have applications in medicinal chemistry and drug development, warranting further investigation into its properties and potential uses.

Formula: C₆H₈N₄O₃

InChI: InChI=1S/C6H8N4O3/c1-3(11)7-6-8-4(9-10-6)2-5(12)13/h2H2,1H3,(H,12,13)(H2,7,8,9,10,11)

InChI key: InChIKey=JLZNHGWFLBIENS-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1NC(NC(C)=O)=NN1

Synonyms:

• 1H-1,2,4-Triazole-3-acetic acid, 5-(acetylamino)-
• 5-(Acetylamino)-1H-1,2,4-triazole-3-acetic acid

[5-(acetylamino)-1H-1,2,4-triazol-3-yl]acetic acid

CAS: 869942-33-6

Formula: C₆H₈N₄O₃

Molecular weight: 184.1527

Ref: IN-DA00GVUP

[5-(acetylamino)-1H-1,2,4-triazol-3-yl]acetic acid

CAS: 869942-33-6

Formula: C₆H₈N₄O₃

Purity: 95.0%

Molecular weight: 184.155

Ref: 10-F309657