CAS 869942-45-0

N-[(2E)-3-phenylprop-2-en-1-yl]butan-2-amine

Description:

N-[(2E)-3-phenylprop-2-en-1-yl]butan-2-amine, with the CAS number 869942-45-0, is an organic compound characterized by its amine functional group and a phenylpropene moiety. This substance features a butan-2-amine backbone, which is a secondary amine, indicating the presence of two alkyl groups attached to the nitrogen atom. The (2E)-3-phenylprop-2-en-1-yl group introduces a conjugated double bond system, contributing to the compound's potential reactivity and stability. The presence of the phenyl group enhances its aromatic characteristics, which may influence its solubility and interaction with biological systems. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its behavior in various chemical environments. Additionally, due to its structural features, it may have applications in medicinal chemistry or as a building block in organic synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases.

Formula: C₁₃H₁₉N

InChI: InChI=1/C13H19N/c1-3-12(2)14-11-7-10-13-8-5-4-6-9-13/h4-10,12,14H,3,11H2,1-2H3/b10-7+

Synonyms:

• 2-butanamine, N-[(2E)-3-phenyl-2-propen-1-yl]-

sec-butyl[(2E)-3-phenyl-2-propen-1-yl]amine hydrochloride

CAS: 869942-45-0

Formula: C₁₃H₂₀ClN

Purity: 95.0%

Molecular weight: 225.76

Ref: 10-F361728