
CAS 869942-46-1
:2-[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]-1-propanamine
Description:
2-[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]-1-propanamine, identified by its CAS number 869942-46-1, is a chemical compound characterized by its unique structure that includes a thiadiazole ring and a propanamine moiety. The presence of the thiadiazole ring imparts specific biological and chemical properties, often associated with antimicrobial or antifungal activities. The methyl group on the thiadiazole enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its functional groups suggest that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's potential applications may span pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to the potential for toxicity or reactivity.
Formula:C6H11N3S2
InChI:InChI=1S/C6H11N3S2/c1-4(3-7)10-6-9-8-5(2)11-6/h4H,3,7H2,1-2H3
InChI key:InChIKey=LCDXDGGKSWONEG-UHFFFAOYSA-N
SMILES:S(C(CN)C)C=1SC(C)=NN1
Synonyms:- 1-Propanamine, 2-[(5-methyl-1,3,4-thiadiazol-2-yl)thio]-
- 2-[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]-1-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.