CAS 869942-55-2

N-(4-ethylbenzyl)-2-methylpropan-1-amine

Description:

N-(4-ethylbenzyl)-2-methylpropan-1-amine, with the CAS number 869942-55-2, is an organic compound characterized by its amine functional group. This substance features a branched alkyl chain, specifically a 2-methylpropan-1-amine backbone, which contributes to its structural complexity. The presence of the 4-ethylbenzyl group enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. As an amine, it may exhibit basic properties, allowing it to participate in various chemical reactions, such as alkylation or acylation. The compound's molecular structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific biological activity or toxicity data may not be readily available. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(4-ethylbenzyl)-2-methylpropan-1-amine represents a class of compounds that may have diverse applications in organic synthesis and medicinal chemistry.

Formula: C₁₃H₂₁N

InChI: InChI=1/C13H21N/c1-4-12-5-7-13(8-6-12)10-14-9-11(2)3/h5-8,11,14H,4,9-10H2,1-3H3

SMILES: CCc1ccc(cc1)CNCC(C)C

Synonyms:

• benzenemethanamine, 4-ethyl-N-(2-methylpropyl)-

(4-Ethylbenzyl)isobutylamine

CAS: 869942-55-2

Versatile small molecule scaffold

Formula: C₁₃H₂₁N

Purity: Min. 95%

Molecular weight: 191.31 g/mol

Ref: 3D-UJB94255