CAS 869942-62-1

N-(4-ethoxybenzyl)propan-1-amine

Description:

N-(4-ethoxybenzyl)propan-1-amine is an organic compound characterized by its amine functional group and an ethoxy-substituted benzyl moiety. This compound features a propan-1-amine backbone, which contributes to its basicity and potential reactivity. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its solubility in organic solvents and biological membranes. The benzyl group can provide steric hindrance, affecting the compound's interaction with biological targets. As an amine, it may participate in hydrogen bonding, which can impact its physical properties such as boiling point and melting point. Additionally, the compound may exhibit pharmacological activity, making it of interest in medicinal chemistry. Its CAS number, 869942-62-1, allows for precise identification in chemical databases and literature. Overall, N-(4-ethoxybenzyl)propan-1-amine is a compound with unique structural features that may confer specific chemical and biological properties, warranting further investigation for potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₁₉NO

InChI: InChI=1/C12H19NO/c1-3-9-13-10-11-5-7-12(8-6-11)14-4-2/h5-8,13H,3-4,9-10H2,1-2H3

SMILES: CCCNCc1ccc(cc1)OCC

Synonyms:

• benzenemethanamine, 4-ethoxy-N-propyl-

N-(4-ethoxybenzyl)-1-propanamine hydrochloride

CAS: 869942-62-1

Formula: C₁₂H₂₀ClNO

Purity: 95.0%

Molecular weight: 229.75

Ref: 10-F361725