CAS 869942-65-4

2-Methoxy-N-(1-methylpropyl)benzenemethanamine

Description:

2-Methoxy-N-(1-methylpropyl)benzenemethanamine, with the CAS number 869942-65-4, is an organic compound characterized by its aromatic structure and the presence of both methoxy and amine functional groups. This compound features a methoxy group (-OCH3) attached to a benzene ring, which enhances its solubility in organic solvents and may influence its reactivity. The N-(1-methylpropyl) substituent indicates that the amine group is connected to a branched alkyl chain, which can affect the compound's steric properties and biological activity. Generally, compounds of this type may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of both hydrophobic and hydrophilic regions in its structure can lead to interesting interactions with biological membranes and receptors. Additionally, the compound's stability, reactivity, and potential applications would depend on its specific molecular interactions and the conditions under which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₉NO

InChI: InChI=1S/C12H19NO/c1-4-10(2)13-9-11-7-5-6-8-12(11)14-3/h5-8,10,13H,4,9H2,1-3H3

InChI key: InChIKey=MRINNIJISAVYPH-UHFFFAOYSA-N

SMILES: C(NC(CC)C)C1=C(OC)C=CC=C1

Synonyms:

• 2-Methoxy-N-(1-methylpropyl)benzenemethanamine
• Benzenemethanamine, 2-methoxy-N-(1-methylpropyl)-