CymitQuimica logo

CAS 869942-68-7

:

N-(2-methoxybenzyl)-2-methylpropan-2-amine

Description:
N-(2-methoxybenzyl)-2-methylpropan-2-amine, identified by its CAS number 869942-68-7, is a chemical compound that belongs to the class of amines. It features a secondary amine structure, characterized by the presence of a methoxybenzyl group attached to a branched alkyl chain. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The methoxy group may also impart certain electronic effects, potentially affecting the compound's reactivity and interaction with biological systems. Additionally, due to its structural features, it may exhibit lipophilicity, allowing it to cross biological membranes. The compound's specific applications and biological activity would depend on its interaction with various receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C12H19NO
InChI:InChI=1/C12H19NO/c1-12(2,3)13-9-10-7-5-6-8-11(10)14-4/h5-8,13H,9H2,1-4H3
SMILES:CC(C)(C)NCc1ccccc1OC
Synonyms:
  • N-(2-Methoxyphenylmethyl)tert-butylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.