CAS 869943-02-2
:2-[(4-fluorobenzyl)amino]butan-1-ol
Description:
2-[(4-Fluorobenzyl)amino]butan-1-ol, with the CAS number 869943-02-2, is an organic compound characterized by its amine and alcohol functional groups. This substance features a butanol backbone, where a hydroxyl (-OH) group is attached to the first carbon, and a 4-fluorobenzyl group is substituted at the second carbon through an amino (-NH-) linkage. The presence of the fluorine atom on the benzyl ring can influence the compound's electronic properties and biological activity. Typically, compounds like this may exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, affecting solubility in polar solvents. The structural configuration suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the fluorinated aromatic ring may enhance metabolic stability or receptor binding. Additionally, the compound's synthesis and reactivity can be influenced by the presence of both the amine and alcohol functionalities, making it a versatile intermediate in organic synthesis.
Formula:C11H16FNO
InChI:InChI=1/C11H16FNO/c1-2-11(8-14)13-7-9-3-5-10(12)6-4-9/h3-6,11,13-14H,2,7-8H2,1H3
SMILES:CCC(CO)NCc1ccc(cc1)F
Synonyms:- 1-Butanol, 2-[[(4-Fluorophenyl)Methyl]Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.