CymitQuimica logo

CAS 869943-15-7

:

7-(Difluoromethyl)-4,5,6,7-tetrahydro-2,5-dimethylpyrazolo[1,5-a]pyrimidine

Description:
7-(Difluoromethyl)-4,5,6,7-tetrahydro-2,5-dimethylpyrazolo[1,5-a]pyrimidine is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrazole and a pyrimidine moiety. This compound features a difluoromethyl group, contributing to its potential reactivity and biological activity. The tetrahydro configuration indicates the presence of a saturated ring system, which can influence the compound's physical properties, such as solubility and stability. The presence of two methyl groups enhances its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its CAS number, 869943-15-7, serves as a unique identifier for regulatory and research purposes. Overall, the structural features of this compound suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities and applications would require further investigation.
Formula:C9H13F2N3
InChI:InChI=1S/C9H13F2N3/c1-5-3-7(9(10)11)14-8(12-5)4-6(2)13-14/h4-5,7,9,12H,3H2,1-2H3
InChI key:InChIKey=GVCUYVSDJYMDMA-UHFFFAOYSA-N
SMILES:C(F)(F)C1N2C(=CC(C)=N2)NC(C)C1
Synonyms:
  • 7-(Difluoromethyl)-4,5,6,7-tetrahydro-2,5-dimethylpyrazolo[1,5-a]pyrimidine
  • Pyrazolo[1,5-a]pyrimidine, 7-(difluoromethyl)-4,5,6,7-tetrahydro-2,5-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.